| Product Name | 3-morpholino-1,2-propanediol |
| CAS No. | 6425-32-7 |
| Synonyms | 3-(4-Morpholino)-1,2-propanediol; 3-(morpholin-4-yl)propane-1,2-diol |
| InChI | InChI=1/C7H15NO3/c9-6-7(10)5-8-1-3-11-4-2-8/h7,9-10H,1-6H2 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.1989 |
| Density | 1.167g/cm3 |
| Melting point | 37-38℃ |
| Boiling point | 290.1°C at 760 mmHg |
| Flash point | 136.9°C |
| Refractive index | 1.5 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6425-32-7 3-morpholino-1,2-propanediol
service@apichina.com