| Product Name | 3-Methylthiophene-2-methylamine |
| CAS No. | 104163-35-1 |
| Synonyms | 2-Aminomethyl-3-methylthiophene; (3-Methyl-2-thienyl)methylamine; 1-(3-methylthiophen-2-yl)methanamine |
| InChI | InChI=1/C6H9NS/c1-5-2-3-8-6(5)4-7/h2-3H,4,7H2,1H3 |
| Molecular Formula | C6H9NS |
| Molecular Weight | 127.2074 |
| Density | 1.104g/cm3 |
| Boiling point | 204.6°C at 760 mmHg |
| Flash point | 77.5°C |
| Refractive index | 1.572 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
104163-35-1 3-methylthiophene-2-methylamine
service@apichina.com