| Product Name | 3-Methylthiophene-2-carboxylic acid |
| CAS No. | 23806-24-8 |
| Synonyms | 3-Methyl-2-thiophenecarboxylic acid; 3-methylthiophene-2-carboxylate; RARECHEM AL BO 0517; 3-Methylthiophene-2-carboxylic |
| InChI | InChI=1/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8)/p-1 |
| Molecular Formula | C6H5O2S |
| Molecular Weight | 141.1682 |
| Melting point | 145-146℃ |
| Boiling point | 274°C at 760 mmHg |
| Flash point | 119.5°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:; |
23806-24-8 3-methylthiophene-2-carboxylic acid
service@apichina.com