| Product Name | 3-Methylthiophene-2-carbonyl chloride |
| CAS No. | 61341-26-2 |
| Synonyms | 2-thiophenecarbonyl chloride, 3-methyl-; 3-METHYLTHIOPHENE-2-CARBONYL CHLORIDE |
| InChI | InChI=1/C6H5ClOS/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3 |
| Molecular Formula | C6H5ClOS |
| Molecular Weight | 160.6213 |
| Density | 1.32g/cm3 |
| Boiling point | 219.9°C at 760 mmHg |
| Flash point | 86.8°C |
| Refractive index | 1.566 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
61341-26-2 3-methylthiophene-2-carbonyl chloride
service@apichina.com