| Product Name | 3-(methylthio)phenyl isocyanate |
| CAS No. | 28479-19-8 |
| Synonyms | 3-(Methylthio)phenyl isocyanate; 1-isocyanato-3-(methylsulfanyl)benzene |
| InChI | InChI=1/C8H7NOS/c1-11-8-4-2-3-7(5-8)9-6-10/h2-5H,1H3 |
| Molecular Formula | C8H7NOS |
| Molecular Weight | 165.2123 |
| Density | 1.11g/cm3 |
| Boiling point | 253.2°C at 760 mmHg |
| Flash point | 106.9°C |
| Refractive index | 1.566 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
28479-19-8 3-(methylthio)phenyl isocyanate
service@apichina.com