| Product Name | 3-Methylthianaphthene-2-acetic acid |
| CAS No. | 1505-52-8 |
| Synonyms | 2-(3-Methylbenzo[b]thiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetic acid; (3-methyl-1-benzothiophen-2-yl)acetate |
| InChI | InChI=1/C11H10O2S/c1-7-8-4-2-3-5-9(8)14-10(7)6-11(12)13/h2-5H,6H2,1H3,(H,12,13)/p-1 |
| Molecular Formula | C11H9O2S |
| Molecular Weight | 205.2535 |
| Melting point | 148-150℃ |
| Boiling point | 391.8°C at 760 mmHg |
| Flash point | 190.8°C |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1505-52-8 3-methylthianaphthene-2-acetic acid
service@apichina.com