| Product Name | 3-Methylglutaric anhydride |
| CAS No. | 4166-53-4 |
| Synonyms | 4-methyldihydro-2H-pyran-2,6(3H)-dione |
| InChI | InChI=1/C6H8O3/c1-4-2-5(7)9-6(8)3-4/h4H,2-3H2,1H3 |
| Molecular Formula | C6H8O3 |
| Molecular Weight | 128.1259 |
| Density | 1.159g/cm3 |
| Melting point | 40-45℃ |
| Boiling point | 299.5°C at 760 mmHg |
| Flash point | 113°C |
| Refractive index | 1.448 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
4166-53-4 3-methylglutaric anhydride
service@apichina.com