| Product Name | 3-Methylcyclopentanol, mixture of isomers |
| CAS No. | 18729-48-1 |
| Synonyms | 1-Methyl-3-cyclopentanol; 3-methylcyclopentanol; (1S,3S)-3-methylcyclopentanol |
| InChI | InChI=1/C6H12O/c1-5-2-3-6(7)4-5/h5-7H,2-4H2,1H3/t5-,6-/m0/s1 |
| Molecular Formula | C6H12O |
| Molecular Weight | 100.1589 |
| Density | 0.947g/cm3 |
| Boiling point | 146.9°C at 760 mmHg |
| Flash point | 55°C |
| Refractive index | 1.467 |
| Risk Codes | R10:Flammable.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; |
18729-48-1 3-methylcyclopentanol, mixture of isomers
service@apichina.com