| Product Name | 3-Methylbenzyl mercaptan |
| CAS No. | 25697-56-7 |
| Synonyms | 3-Methyl-alpha-toluenethiol; 3-Methylbenzylthiol; (3-Methylphenyl)methanethiol |
| InChI | InChI=1/C8H10S/c1-7-3-2-4-8(5-7)6-9/h2-5,9H,6H2,1H3 |
| Molecular Formula | C8H10S |
| Molecular Weight | 138.23 |
| Density | 1.015g/cm3 |
| Boiling point | 217°C at 760 mmHg |
| Flash point | 85.3°C |
| Refractive index | 1.558 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
25697-56-7 3-methylbenzyl mercaptan
service@apichina.com