| Product Name | (+)-3-Methyladipic acid |
| CAS No. | 623-82-5 |
| Synonyms | Methylhexanedioic acid; (3R)-3-methylhexanedioic acid; (3R)-3-methylhexanedioate |
| InChI | InChI=1/C7H12O4/c1-5(4-7(10)11)2-3-6(8)9/h5H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2/t5-/m1/s1 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.153 |
| Melting point | 81-84℃ |
| Boiling point | 341.4°C at 760 mmHg |
| Flash point | 170.6°C |
| Hazard Symbols | |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
623-82-5 (+)-3-methyladipic acid
service@apichina.com