| Product Name | 3-methyl-5-phenyl-4-isoxazolecarboxylic acid |
| CAS No. | 17153-21-8 |
| Synonyms | 3-methyl-5-phenylisoxazole-4-carboxylic acid |
| InChI | InChI=1/C11H9NO3/c1-7-9(11(13)14)10(15-12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,13,14) |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.1941 |
| Density | 1.274g/cm3 |
| Melting point | 191℃ |
| Boiling point | 362.079°C at 760 mmHg |
| Flash point | 172.779°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
17153-21-8 3-methyl-5-phenyl-4-isoxazolecarboxylic acid
service@apichina.com