| Product Name | 3-methyl-5-phenyl-4-isoxazolecarbonyl chloride |
| CAS No. | 91182-77-3 |
| Synonyms | 3-methyl-5-phenylisoxazole-4-carbonyl chloride |
| InChI | InChI=1/C11H8ClNO2/c1-7-9(11(12)14)10(15-13-7)8-5-3-2-4-6-8/h2-6H,1H3 |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.6397 |
| Density | 1.278g/cm3 |
| Boiling point | 369.1°C at 760 mmHg |
| Flash point | 177°C |
| Refractive index | 1.562 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
91182-77-3 3-methyl-5-phenyl-4-isoxazolecarbonyl chloride
service@apichina.com