| Product Name | 3-methyl-5-(5-methylisoxazol-3-yl)isoxazol-4-carbonylchloride |
| CAS No. | 306936-71-0 |
| Synonyms | 3',5-dimethyl-3,5'-biisoxazole-4'-carbonyl chloride |
| InChI | InChI=1/C9H7ClN2O3/c1-4-3-6(12-14-4)8-7(9(10)13)5(2)11-15-8/h3H,1-2H3 |
| Molecular Formula | C9H7ClN2O3 |
| Molecular Weight | 226.6165 |
| Density | 1.367g/cm3 |
| Melting point | 57℃ |
| Boiling point | 400°C at 760 mmHg |
| Flash point | 195.7°C |
| Refractive index | 1.534 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
306936-71-0 3-methyl-5-(5-methylisoxazol-3-yl)isoxazol-4-carbonylchloride
service@apichina.com