| Product Name | 3-methyl-5-(4-methyl-1,2,3-thiadiazol-5-yl)isoxazole-4-carboxylic acid |
| CAS No. | 263385-59-7 |
| InChI | InChI=1/C8H7N3O3S/c1-3-5(8(12)13)6(14-10-3)7-4(2)9-11-15-7/h1-2H3,(H,12,13) |
| Molecular Formula | C8H7N3O3S |
| Molecular Weight | 225.2245 |
| Density | 1.484g/cm3 |
| Melting point | 224℃ |
| Boiling point | 388°C at 760 mmHg |
| Flash point | 188.5°C |
| Refractive index | 1.606 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
263385-59-7 3-methyl-5-(4-methyl-1,2,3-thiadiazol-5-yl)isoxazole-4-carboxylic acid
service@apichina.com