| Product Name | 3-Methyl-4-phenylpyrazole |
| CAS No. | 13788-84-6 |
| Synonyms | 3-Methyl-4-phenylpyrazol; 3-methyl-4-phenyl-1H-pyrazole |
| InChI | InChI=1/C10H10N2/c1-8-10(7-11-12-8)9-5-3-2-4-6-9/h2-7H,1H3,(H,11,12) |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.1998 |
| Density | 1.109g/cm3 |
| Melting point | 142-144℃ |
| Boiling point | 321.2°C at 760 mmHg |
| Flash point | 148.4°C |
| Refractive index | 1.591 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
13788-84-6 3-methyl-4-phenylpyrazole
service@apichina.com