| Product Name | 3-methyl-4-nitroisoxazol-5-amine |
| CAS No. | 41230-51-7 |
| Synonyms | 3-methyl-4-nitro-1,2-oxazol-5-amine |
| InChI | InChI=1/C4H5N3O3/c1-2-3(7(8)9)4(5)10-6-2/h5H2,1H3 |
| Molecular Formula | C4H5N3O3 |
| Molecular Weight | 143.1008 |
| Density | 1.492g/cm3 |
| Melting point | 154℃ |
| Boiling point | 334.4°C at 760 mmHg |
| Flash point | 156°C |
| Refractive index | 1.587 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
41230-51-7 3-methyl-4-nitroisoxazol-5-amine
service@apichina.com