| Product Name | 3-Methyl-4-nitrobenzonitrile |
| CAS No. | 96784-54-2 |
| Synonyms | 4-Nitro-m-tolunitrile |
| InChI | InChI=1/C8H6N2O2/c1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4H,1H3 |
| Molecular Formula | C8H6N2O2 |
| Molecular Weight | 162.1454 |
| Density | 1.26g/cm3 |
| Melting point | 82-83℃ |
| Boiling point | 322.2°C at 760 mmHg |
| Flash point | 148.6°C |
| Refractive index | 1.568 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
96784-54-2 3-methyl-4-nitrobenzonitrile
service@apichina.com