| Product Name | 3-Methyl-4-isopropylaniline hydrochloride |
| CAS No. | 4534-11-6 |
| Synonyms | 4-Isopropyl-3-methylaniline hydrochloride; 3-methyl-4-(1-methylethyl)aniline hydrochloride; 3-methyl-4-(1-methylethyl)aniline |
| InChI | InChI=1/C10H15N/c1-7(2)10-5-4-9(11)6-8(10)3/h4-7H,11H2,1-3H3 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.2328 |
| Density | 0.944g/cm3 |
| Boiling point | 247°C at 760 mmHg |
| Flash point | 106°C |
| Refractive index | 1.538 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
4534-11-6 3-methyl-4-isopropylaniline hydrochloride
service@apichina.com