| Product Name | 3-Methyl-3-buten-1-ol |
| CAS No. | 763-32-6 |
| Synonyms | Isobutenylcarbinol; 2-Methyl-1-buten-4-ol; 3-Isopentenyl alcohol; Isoprenol; Isopropenylethyl alcohol; Methallylcarbinol; NSC 122673; 3-Buten-1-ol, 3-methyl-; 3-Methylbut-3-en-1-ol |
| InChI | InChI=1/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
| Molecular Formula | C5H10O |
| Molecular Weight | 86.1323 |
| Density | 0.832g/cm3 |
| Boiling point | 114.2°C at 760 mmHg |
| Flash point | 40.1°C |
| Refractive index | 1.422 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36:Irritating to eyes.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S24:Avoid contact with skin.; |
763-32-6 3-methyl-3-buten-1-ol
service@apichina.com