| Product Name | 3-Methyl-2,4,6-tribromoaniline |
| CAS No. | 71642-16-5 |
| Synonyms | 2,4,6-Tribromo-3-methylaniline~2,4,6-Tribromo-m-toluidine; 2,4,6-Tribromo-m-toluidine; 2,4,6-tribromo-3-methylaniline |
| InChI | InChI=1/C7H6Br3N/c1-3-4(8)2-5(9)7(11)6(3)10/h2H,11H2,1H3 |
| Molecular Formula | C7H6Br3N |
| Molecular Weight | 343.8412 |
| Density | 2.196g/cm3 |
| Melting point | 101-102℃ |
| Boiling point | 314.1°C at 760 mmHg |
| Flash point | 143.8°C |
| Refractive index | 1.668 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
71642-16-5 3-methyl-2,4,6-tribromoaniline
service@apichina.com