| Product Name | 3-Methoxyphenoxyacetic acid |
| CAS No. | 2088-24-6 |
| Synonyms | Acetic acid, (3-methoxyphenoxy)-; (3-Methoxyphenoxy)acetic acid |
| InChI | InChI=1/C9H10O4/c1-12-7-3-2-4-8(5-7)13-6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.1733 |
| Density | 1.226g/cm3 |
| Boiling point | 325.9°C at 760 mmHg |
| Flash point | 131.9°C |
| Refractive index | 1.528 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2088-24-6 3-methoxyphenoxyacetic acid
service@apichina.com