| Product Name | 3-Methoxycatechol |
| CAS No. | 934-00-9 |
| Synonyms | Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
| InChI | InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.1366 |
| Density | 1.27g/cm3 |
| Melting point | 39-43℃ |
| Boiling point | 268.1°C at 760 mmHg |
| Flash point | 119.5°C |
| Refractive index | 1.579 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
934-00-9 3-methoxycatechol
service@apichina.com