| Product Name | 3-Methoxybenzhydrazide |
| CAS No. | 5785-06-8 |
| Synonyms | m-Anisic hydrazide; 3-Methoxybenzoic hydrazide; 3-methoxybenzohydrazide |
| InChI | InChI=1/C8H10N2O2/c1-12-7-4-2-3-6(5-7)8(11)10-9/h2-5H,9H2,1H3,(H,10,11) |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.1772 |
| Density | 1.178g/cm3 |
| Melting point | 91℃ |
| Refractive index | 1.558 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
5785-06-8 3-methoxybenzhydrazide
service@apichina.com