| Product Name | 3-isocyanatobenzoyl chloride |
| CAS No. | 5180-79-0 |
| InChI | InChI=1/C8H4ClNO2/c9-8(12)6-2-1-3-7(4-6)10-5-11/h1-4H |
| Molecular Formula | C8H4ClNO2 |
| Molecular Weight | 181.5759 |
| Density | 1.28g/cm3 |
| Boiling point | 267.5°C at 760 mmHg |
| Flash point | 107.1°C |
| Refractive index | 1.567 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R34:Causes burns.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
5180-79-0 3-isocyanatobenzoyl chloride
service@apichina.com