| Product Name | 3-Isocyanatobenzoic acid ethyl ester |
| CAS No. | 67531-68-4 |
| Synonyms | 3-(Ethoxycarbonyl)phenyl isocyanate; 3-Carboethoxyphenyl isocyanate~Ethyl 3-isocyanatobenzoate; ethyl 3-isocyanatobenzoate |
| InChI | InChI=1/C10H9NO3/c1-2-14-10(13)8-4-3-5-9(6-8)11-7-12/h3-6H,2H2,1H3 |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.1834 |
| Density | 1.12g/cm3 |
| Boiling point | 286.9°C at 760 mmHg |
| Flash point | 131.2°C |
| Refractive index | 1.524 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; R42:May cause sensitization by inhalation.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
67531-68-4 3-isocyanatobenzoic acid ethyl ester
service@apichina.com