| Product Name | 3-Iodopropionic acid |
| CAS No. | 141-76-4 |
| Synonyms | Iodopropionicacid; 3-iodopropanoic acid; 3-iodopropanoate |
| InChI | InChI=1/C3H5IO2/c4-2-1-3(5)6/h1-2H2,(H,5,6)/p-1 |
| Molecular Formula | C3H4IO2 |
| Molecular Weight | 198.9677 |
| Melting point | 80-85℃ |
| Boiling point | 259.7°C at 760 mmHg |
| Flash point | 110.9°C |
| Hazard Symbols | |
| Risk Codes | R34:Causes burns.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
141-76-4 3-iodopropionic acid
service@apichina.com
- Next:141-78-6 ethyl acetate
- Previous:141-75-3 butyryl chloride