| Product Name | 3-iodophthalic acid |
| CAS No. | 6937-34-4 |
| Synonyms | 3-iodobenzene-1,2-dicarboxylic acid; 3-Iodophthaltc acid |
| InChI | InChI=1/C8H5IO4/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| Molecular Formula | C8H5IO4 |
| Molecular Weight | 292.0274 |
| Density | 2.138g/cm3 |
| Melting point | 232℃ |
| Boiling point | 426.3°C at 760 mmHg |
| Flash point | 211.6°C |
| Refractive index | 1.704 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6937-34-4 3-iodophthalic acid
service@apichina.com