| Product Name | 3-iodobenzoyl chloride |
| CAS No. | 1711-10-0 |
| InChI | InChI=1/C7H4ClIO/c8-7(10)5-2-1-3-6(9)4-5/h1-4H |
| Molecular Formula | C7H4ClIO |
| Molecular Weight | 266.46 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
1711-10-0 3-iodobenzoyl chloride
service@apichina.com