| Product Name | 3-Indolylacetonitrile |
| CAS No. | 771-51-7 |
| Synonyms | Indole-3-acetonitrile,(Indolyl-3-acetonitrile); Indolyl-3-acetonitrile; Indole-3-acetonitrile; 1H-Indole-3-acetonitrile; BETA-INDOLYLACETONITRILE; 2-(1H-INDOL-3-YL)ACETONITRILE; (1H-INDOL-3-YL)-ACETONITRILE; 3-INDOLEACETONITRILE; 3-Indole acetonitrile |
| InChI | InChI=1/C10H8N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5H2 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.18 |
| Density | 158 |
| Melting point | 33-35℃ |
| Boiling point | 156-160℃(0.2 torr) |
| Flash point | 206℃ |
| Refractive index | 1.6085-1.6105 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
771-51-7 3-indolylacetonitrile
service@apichina.com