| Product Name | 3-Hydroxyphenylacetylene |
| CAS No. | 10401-11-3 |
| Synonyms | 3-Ethynylphenol |
| InChI | InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| Molecular Formula | C8H6O |
| Molecular Weight | 118.1326 |
| Density | 1.12g/cm3 |
| Boiling point | 230.9°C at 760 mmHg |
| Flash point | 106.1°C |
| Refractive index | 1.589 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
10401-11-3 3-hydroxyphenylacetylene
service@apichina.com