| Product Name | 3-Hydroxybutyronitrile |
| CAS No. | 4368-06-3 |
| Synonyms | beta-Hydroxybutyronitrile; 3-hydroxybutanenitrile |
| InChI | InChI=1/C4H7NO/c1-4(6)2-3-5/h4,6H,2H2,1H3 |
| Molecular Formula | C4H7NO |
| Molecular Weight | 85.1045 |
| Density | 0.991g/cm3 |
| Boiling point | 217.3°C at 760 mmHg |
| Flash point | 85.2°C |
| Refractive index | 1.425 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4368-06-3 3-hydroxybutyronitrile
service@apichina.com