| Product Name | 3-Hydroxy-4-methoxytoluene |
| CAS No. | 1195-09-1 |
| Synonyms | 2-Methoxy-5-methylphenol; Isocreosol~5-Methylguaiacol |
| InChI | InChI=1/C8H10O2/c1-6-3-4-8(10-2)7(9)5-6/h3-5,9H,1-2H3 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.1638 |
| Density | 1.078g/cm3 |
| Boiling point | 226.4°C at 760 mmHg |
| Flash point | 99°C |
| Refractive index | 1.53 |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
1195-09-1 3-hydroxy-4-methoxytoluene
service@apichina.com