| Product Name | 3-Hydroxy-4-methoxybenzyl alcohol |
| CAS No. | 4383-06-6 |
| Synonyms | Isovanillyl alcohol; 5-(hydroxymethyl)-2-methoxyphenol |
| InChI | InChI=1/C8H10O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,9-10H,5H2,1H3 |
| Molecular Formula | C8H10O3 |
| Molecular Weight | 154.1632 |
| Density | 1.226g/cm3 |
| Melting point | 135-137℃ |
| Boiling point | 315.8°C at 760 mmHg |
| Flash point | 144.8°C |
| Refractive index | 1.57 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S22:; S24/25:; |
4383-06-6 3-hydroxy-4-methoxybenzyl alcohol
service@apichina.com