| Product Name | 3-Hydroxy-2-Methyl Benzoic Acid |
| CAS No. | 603-80-5 |
| Synonyms | 3-Hydroxy-2-methylbenzoic acid; Hydroxytoluicacid; 3-Hydroxy-o-toluic acid; 2-methyl-3-hydroxybenzoic acid; 3-hydroxy-2-methylbenzoate; 2-Methyl-3-hydroxy benzoic acid |
| InChI | InChI=1/C8H8O3/c1-5-6(8(10)11)3-2-4-7(5)9/h2-4,9H,1H3,(H,10,11)/p-1 |
| Molecular Formula | C8H7O3 |
| Molecular Weight | 151.1399 |
| Melting point | 143-148℃ |
| Boiling point | 336.6°C at 760 mmHg |
| Flash point | 171.6°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
603-80-5 3-hydroxy-2-methyl benzoic acid
service@apichina.com