| Product Name | 3-Hydroxy-2,4,6-triiodobenzoic acid |
| CAS No. | 53279-72-4 |
| Synonyms | 2,4,6-Triiodo-3-hydroxybenzoic acid; 3-hydroxy-2,4,6-triiodobenzoate; HTBA |
| InChI | InChI=1/C7H3I3O3/c8-2-1-3(9)6(11)5(10)4(2)7(12)13/h1,11H,(H,12,13)/p-1 |
| Molecular Formula | C7H2I3O3 |
| Molecular Weight | 514.8029 |
| Boiling point | 389.2°C at 760 mmHg |
| Flash point | 189.2°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
53279-72-4 3-hydroxy-2,4,6-triiodobenzoic acid
service@apichina.com