| Product Name | 3-Hydroxy-2,4,6-tribromobenzaldehyde |
| CAS No. | 2737-22-6 |
| Synonyms | 2,4,6-Tribromo-3-hydroxybenzaldehyde |
| InChI | InChI=1/C7H3Br3O2/c8-4-1-5(9)7(12)6(10)3(4)2-11/h1-2,12H |
| Molecular Formula | C7H3Br3O2 |
| Molecular Weight | 358.8095 |
| Density | 2.423g/cm3 |
| Boiling point | 305.9°C at 760 mmHg |
| Flash point | 138.8°C |
| Refractive index | 1.711 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2737-22-6 3-hydroxy-2,4,6-tribromobenzaldehyde
service@apichina.com