| Product Name | 3-Heptanol |
| CAS No. | 589-82-2 |
| Synonyms | heptan-3-ol; (3R)-heptan-3-ol; (3S)-heptan-3-ol |
| InChI | InChI=1/C7H16O/c1-3-5-6-7(8)4-2/h7-8H,3-6H2,1-2H3/t7-/m0/s1 |
| Molecular Formula | C7H16O |
| Molecular Weight | 116.2013 |
| Density | 0.818g/cm3 |
| Melting point | -70℃ |
| Boiling point | 156.7°C at 760 mmHg |
| Flash point | 54.4°C |
| Refractive index | 1.42 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
589-82-2 3-heptanol
service@apichina.com