| Product Name | 3-furancarboximidamide hydrochloride |
| CAS No. | 54649-21-7 |
| Synonyms | furan-3-carboximidamide hydrochloride |
| InChI | InChI=1/C5H6N2O.ClH/c6-5(7)4-1-2-8-3-4;/h1-3H,(H3,6,7);1H |
| Molecular Formula | C5H7ClN2O |
| Molecular Weight | 146.5749 |
| Melting point | 74℃ |
| Boiling point | 178.9°C at 760 mmHg |
| Flash point | 62°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
54649-21-7 3-furancarboximidamide hydrochloride
service@apichina.com