| Product Name | 3-furancarbothioamide |
| CAS No. | 59918-68-2 |
| Synonyms | furan-3-carbothioamide |
| InChI | InChI=1/C5H5NOS/c6-5(8)4-1-2-7-3-4/h1-3H,(H2,6,8) |
| Molecular Formula | C5H5NOS |
| Molecular Weight | 127.1643 |
| Density | 1.287g/cm3 |
| Melting point | 74℃ |
| Boiling point | 219.6°C at 760 mmHg |
| Flash point | 86.6°C |
| Refractive index | 1.62 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
59918-68-2 3-furancarbothioamide
service@apichina.com