| Product Name | 3-Formylthiophene-2-boronic acid |
| CAS No. | 17303-83-2 |
| Synonyms | 2-Boronothiophene-3-carboxaldehyde; (3-Formyl-2-thienyl)boronic acid; (3-formylthiophen-2-yl)boronic acid |
| InChI | InChI=1/C5H5BO3S/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
| Molecular Formula | C5H5BO3S |
| Molecular Weight | 155.9674 |
| Density | 1.41g/cm3 |
| Melting point | 330℃ |
| Boiling point | 381.2°C at 760 mmHg |
| Flash point | 184.4°C |
| Refractive index | 1.573 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
17303-83-2 3-formylthiophene-2-boronic acid
service@apichina.com