| Product Name | 3-Formylfuran-2-boronic acid |
| CAS No. | 27339-38-4 |
| Synonyms | 2-Borono-3-furaldehyde; (3-formylfuran-2-yl)boronic acid |
| InChI | InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
| Molecular Formula | C5H5BO4 |
| Molecular Weight | 139.9018 |
| Density | 1.36g/cm3 |
| Boiling point | 346.6°C at 760 mmHg |
| Flash point | 163.4°C |
| Refractive index | 1.51 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
27339-38-4 3-formylfuran-2-boronic acid
service@apichina.com