| Product Name | 3-fluoropropiophenone |
| CAS No. | 455-67-4 |
| Synonyms | 3'-FLUOROPROPIOPHENONE; 1-(3-fluorophenyl)propan-1-one |
| InChI | InChI=1/C9H9FO/c1-2-9(11)7-4-3-5-8(10)6-7/h3-6H,2H2,1H3 |
| Molecular Formula | C9H9FO |
| Molecular Weight | 152.1656 |
| Density | 1.074g/cm3 |
| Boiling point | 209.8°C at 760 mmHg |
| Flash point | 79.8°C |
| Refractive index | 1.489 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
455-67-4 3-fluoropropiophenone
service@apichina.com