| Product Name | 3-Fluorophenylglyoxal hydrate |
| CAS No. | 121247-01-6 |
| Synonyms | (3-fluorophenyl)(oxo)acetaldehyde hydrate |
| InChI | InChI=1/C8H5FO2.H2O/c9-7-3-1-2-6(4-7)8(11)5-10;/h1-5H;1H2 |
| Molecular Formula | C8H7FO3 |
| Molecular Weight | 170.1378 |
| Boiling point | 213.4°C at 760 mmHg |
| Flash point | 80°C |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
121247-01-6 3-fluorophenylglyoxal hydrate
service@apichina.com