| Product Name | 3-fluorobenzal chloride |
| CAS No. | 402-64-2 |
| Synonyms | alpha,alpha-Dichloro-3-fluorotoluene |
| InChI | InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H |
| Molecular Formula | C7H5Cl2F |
| Molecular Weight | 179.02 |
| Boiling point | 195℃ |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
402-64-2 3-fluorobenzal chloride
service@apichina.com