| Product Name | 3-Fluoro-4-methylbenzoyl chloride |
| CAS No. | 59189-97-8 |
| Synonyms | 3-Fluoro-p-toluoyl chloride |
| InChI | InChI=1/C8H6ClFO/c1-5-2-3-6(8(9)11)4-7(5)10/h2-4H,1H3 |
| Molecular Formula | C8H6ClFO |
| Molecular Weight | 172.584 |
| Density | 1.265g/cm3 |
| Boiling point | 223.4°C at 760 mmHg |
| Flash point | 88.9°C |
| Refractive index | 1.518 |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
59189-97-8 3-fluoro-4-methylbenzoyl chloride
service@apichina.com