| Product Name | 3-Fluoro-4-methylbenzonitrile |
| CAS No. | 170572-49-3 |
| Synonyms | 4-Cyano-2-fluorotoluene; 3-Fluoro-p-tolunitrile |
| InChI | InChI=1/C8H6FN/c1-6-2-3-7(5-10)4-8(6)9/h2-4H,1H3 |
| Molecular Formula | C8H6FN |
| Molecular Weight | 135.1383 |
| Density | 1.117g/cm3 |
| Melting point | 48-50℃ |
| Boiling point | 215.069°C at 760 mmHg |
| Flash point | 90.3°C |
| Refractive index | 1.508 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
170572-49-3 3-fluoro-4-methylbenzonitrile
service@apichina.com