| Product Name | 3-Fluoro-4-methylbenzaldehyde |
| CAS No. | 177756-62-6 |
| Synonyms | 3-Fluoro-p-tolualdehyde |
| InChI | InChI=1/C8H7FO/c1-6-2-3-7(5-10)4-8(6)9/h2-5H,1H3 |
| Molecular Formula | C8H7FO |
| Molecular Weight | 138.139 |
| Density | 1.136g/cm3 |
| Boiling point | 198.3°C at 760 mmHg |
| Flash point | 80.1°C |
| Refractive index | 1.534 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
177756-62-6 3-fluoro-4-methylbenzaldehyde
service@apichina.com