| Product Name | 3-fluoro-4-methoxybenzonitrile |
| CAS No. | 331-62-4 |
| Synonyms | Fluoromethoxybenzonitrile |
| InChI | InChI=1/C8H6FNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,1H3 |
| Molecular Formula | C8H6FNO |
| Molecular Weight | 151.1377 |
| Density | 1.18g/cm3 |
| Boiling point | 254.3°C at 760 mmHg |
| Flash point | 107.6°C |
| Refractive index | 1.505 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
331-62-4 3-fluoro-4-methoxybenzonitrile
service@apichina.com