| Product Name | 3-Ethylaniline |
| CAS No. | 587-02-0 |
| Synonyms | 3-Ethylbenzenamine; 3-Ethylphenylamine; 4-12-00-02417 (Beilstein Handbook Reference); BRN 0636282; m-Ethylaniline; Aniline, m-ethyl-; Benzenamine, 3-ethyl- (9CI) |
| InChI | InChI=1/C8H11N/c1-2-7-4-3-5-8(9)6-7/h3-6H,2,9H2,1H3 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.1796 |
| Density | 0.973g/cm3 |
| Melting point | -8℃ |
| Boiling point | 216.6°C at 760 mmHg |
| Flash point | 85°C |
| Refractive index | 1.556 |
| Hazard Symbols |  T:Toxic; |
| Risk Codes | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.; R33:Danger of cummulative effects.; |
| Safety | S28A:After contact with skin, wash immediately with plenty of water.; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
587-02-0 3-ethylaniline
service@apichina.com