| Product Name | 3-Ethyl-3-methylglutaric anhydride |
| CAS No. | 6970-57-6 |
| InChI | InChI=1/C8H12O3/c1-3-8(2)4-6(9)11-7(10)5-8/h3-5H2,1-2H3 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.1791 |
| Density | 1.066g/cm3 |
| Boiling point | 311.4°C at 760 mmHg |
| Flash point | 95°C |
| Refractive index | 1.443 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
6970-57-6 3-ethyl-3-methylglutaric anhydride
service@apichina.com